C22H23NO3 — CID 25218882
2-(4-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid (PubChem CID 25218882) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid.
| Compound Name | 2-(4-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 25218882 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-(4-butoxyphenyl)-6,8-dimethylquinoline-4-carboxylic acid |
| SMILES | CCCCOc1ccc(-c2cc(C(=O)O)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C22H23NO3/c1-4-5-10-26-17-8-6-16(7-9-17)20-13-19(22(24)25)18-12-14(2)11-15(3)21(18)23-20/h6-9,11-13H,4-5,10H2,1-3H3,(H,24,25) |
| InChIKey | UBQRMHYPPAMPAU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|