2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid

C18H14BrNO2 — CID 997473

IUPAC2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid
SMILESCc1cc(C)c2nc(-c3cccc(Br)c3)cc(C(=O)O)c2c1
InChIInChI=1S/C18H14BrNO2/c1-10-6-11(2)17-14(7-10)15(18(21)22)9-16(20-17)12-4-3-5-13(19)8-12/h3-9H,1-2H3,(H,21,22)
InChIKeyDEMODZFUXXBGSV-UHFFFAOYSA-N
MW356.22 g/mol
LogP4.98
Rot. Bonds2

About 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid

2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid (PubChem CID 997473) has the molecular formula C18H14BrNO2 and a molecular weight of 356.22 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid.

Molecular Properties

Compound Name2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid
PubChem CID997473
Molecular FormulaC18H14BrNO2
Molecular Weight356.22 g/mol
Exact Mass355.02
IUPAC Name2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid
SMILESCc1cc(C)c2nc(-c3cccc(Br)c3)cc(C(=O)O)c2c1
InChIInChI=1S/C18H14BrNO2/c1-10-6-11(2)17-14(7-10)15(18(21)22)9-16(20-17)12-4-3-5-13(19)8-12/h3-9H,1-2H3,(H,21,22)
InChIKeyDEMODZFUXXBGSV-UHFFFAOYSA-N
XLogP4.98
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500356.22
LogP ≤ 54.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid?
The IUPAC name of 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid (CID 997473) is 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid.
What is the SMILES notation for 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid?
The canonical SMILES for 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid is Cc1cc(C)c2nc(-c3cccc(Br)c3)cc(C(=O)O)c2c1.
What is the InChIKey of 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid?
The InChIKey is DEMODZFUXXBGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14BrNO2/c1-10-6-11(2)17-14(7-10)15(18(21)22)9-16(20-17)12-4-3-5-13(19)8-12/h3-9H,1-2H3,(H,21,22).
What are the key properties of 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid?
2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid has a molecular weight of 356.22 g/mol, XLogP of 4.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)-6,8-dimethylquinoline-4-carboxylic acid is sourced from PubChem (CID 997473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).