C19H16BrNO2 — CID 19648155
methyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648155) has the molecular formula C19H16BrNO2 and a molecular weight of 370.25 g/mol. Its IUPAC name is methyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | methyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648155 |
| Molecular Formula | C19H16BrNO2 |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | methyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(Br)cc2)nc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C19H16BrNO2/c1-11-8-12(2)18-15(9-11)16(19(22)23-3)10-17(21-18)13-4-6-14(20)7-5-13/h4-10H,1-3H3 |
| InChIKey | MOMUFCIYNDTGDC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |