C19H16ClNO2 — CID 46779377
2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride (PubChem CID 46779377) has the molecular formula C19H16ClNO2 and a molecular weight of 325.80 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride.
| Compound Name | 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 46779377 |
| Molecular Formula | C19H16ClNO2 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carbonyl chloride |
| SMILES | COc1ccc(-c2cc(C(=O)Cl)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C19H16ClNO2/c1-11-8-12(2)18-15(9-11)16(19(20)22)10-17(21-18)13-4-6-14(23-3)7-5-13/h4-10H,1-3H3 |
| InChIKey | AMOHQACFYBDXOI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|