C29H29NO3 — CID 19648216
(4-tert-butylphenyl) 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648216) has the molecular formula C29H29NO3 and a molecular weight of 439.56 g/mol. Its IUPAC name is (4-tert-butylphenyl) 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (4-tert-butylphenyl) 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648216 |
| Molecular Formula | C29H29NO3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (4-tert-butylphenyl) 2-(4-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | COc1ccc(-c2cc(C(=O)Oc3ccc(C(C)(C)C)cc3)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C29H29NO3/c1-18-15-19(2)27-24(16-18)25(17-26(30-27)20-7-11-22(32-6)12-8-20)28(31)33-23-13-9-21(10-14-23)29(3,4)5/h7-17H,1-6H3 |
| InChIKey | TXOOTCNEPAWMMF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|