C31H25NO2 — CID 19648246
(4-phenylphenyl) 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 19648246) has the molecular formula C31H25NO2 and a molecular weight of 443.55 g/mol. Its IUPAC name is (4-phenylphenyl) 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | (4-phenylphenyl) 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648246 |
| Molecular Formula | C31H25NO2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | (4-phenylphenyl) 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)Oc3ccc(-c4ccccc4)cc3)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C31H25NO2/c1-20-9-11-25(12-10-20)29-19-28(27-18-21(2)17-22(3)30(27)32-29)31(33)34-26-15-13-24(14-16-26)23-7-5-4-6-8-23/h4-19H,1-3H3 |
| InChIKey | KPNJUNKNSZCDNR-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|