C18H14NO2- — CID 7048477
6,8-dimethyl-2-phenylquinoline-4-carboxylate (PubChem CID 7048477) has the molecular formula C18H14NO2- and a molecular weight of 276.31 g/mol. Its IUPAC name is 6,8-dimethyl-2-phenylquinoline-4-carboxylate.
| Compound Name | 6,8-dimethyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7048477 |
| Molecular Formula | C18H14NO2- |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 6,8-dimethyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3)cc(C(=O)[O-])c2c1 |
| InChI | InChI=1S/C18H15NO2/c1-11-8-12(2)17-14(9-11)15(18(20)21)10-16(19-17)13-6-4-3-5-7-13/h3-10H,1-2H3,(H,20,21)/p-1 |
| InChIKey | VSTKTJKCVFHQOQ-UHFFFAOYSA-M |
| XLogP | 2.88 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |