C17H16N2 — CID 62201634
6,8-dimethyl-2-phenylquinolin-4-amine (PubChem CID 62201634) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6,8-dimethyl-2-phenylquinolin-4-amine.
| Compound Name | 6,8-dimethyl-2-phenylquinolin-4-amine |
|---|---|
| PubChem CID | 62201634 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6,8-dimethyl-2-phenylquinolin-4-amine |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3)cc(N)c2c1 |
| InChI | InChI=1S/C17H16N2/c1-11-8-12(2)17-14(9-11)15(18)10-16(19-17)13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,18,19) |
| InChIKey | PUANNGSBNZJKKN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |