C22H19N — CID 122225138
2,4,8-trimethyl-6-phenylphenanthridine (PubChem CID 122225138) has the molecular formula C22H19N and a molecular weight of 297.40 g/mol. Its IUPAC name is 2,4,8-trimethyl-6-phenylphenanthridine.
| Compound Name | 2,4,8-trimethyl-6-phenylphenanthridine |
|---|---|
| PubChem CID | 122225138 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2,4,8-trimethyl-6-phenylphenanthridine |
| SMILES | Cc1ccc2c(c1)c(-c1ccccc1)nc1c(C)cc(C)cc12 |
| InChI | InChI=1S/C22H19N/c1-14-9-10-18-19-13-15(2)11-16(3)21(19)23-22(20(18)12-14)17-7-5-4-6-8-17/h4-13H,1-3H3 |
| InChIKey | CYCIKHFQMVFKMQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|