About 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate
2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate (PubChem CID 19648393) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate |
| PubChem CID | 19648393 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3)c(C)c(C(=O)OCC(C)C)c2c1 |
| InChI | InChI=1S/C23H25NO2/c1-14(2)13-26-23(25)20-17(5)22(18-9-7-6-8-10-18)24-21-16(4)11-15(3)12-19(20)21/h6-12,14H,13H2,1-5H3 |
| InChIKey | SYFNWBWHPHUVIR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate?
The IUPAC name of 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate (CID 19648393) is 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate.
What is the SMILES notation for 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate?
The canonical SMILES for 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate is Cc1cc(C)c2nc(-c3ccccc3)c(C)c(C(=O)OCC(C)C)c2c1.
What is the InChIKey of 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate?
The InChIKey is SYFNWBWHPHUVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25NO2/c1-14(2)13-26-23(25)20-17(5)22(18-9-7-6-8-10-18)24-21-16(4)11-15(3)12-19(20)21/h6-12,14H,13H2,1-5H3.
What are the key properties of 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate?
2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate has a molecular weight of 347.46 g/mol, XLogP of 5.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3,6,8-trimethyl-2-phenylquinoline-4-carboxylate is sourced from PubChem (CID 19648393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).