About [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate
[4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate (PubChem CID 17258128) has the molecular formula C34H30ClNO2
and a molecular weight of 520.07 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate.
Molecular Properties
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate |
| PubChem CID | 17258128 |
| Molecular Formula | C34H30ClNO2 |
| Molecular Weight | 520.07 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Cl)cc3)c(C)c(C(=O)Oc3ccc(C(C)(C)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C34H30ClNO2/c1-21-19-22(2)31-29(20-21)30(23(3)32(36-31)24-11-15-27(35)16-12-24)33(37)38-28-17-13-26(14-18-28)34(4,5)25-9-7-6-8-10-25/h6-20H,1-5H3 |
| InChIKey | GESIFLNAVPZURJ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.07 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate?
The IUPAC name of [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate (CID 17258128) is [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate.
What is the SMILES notation for [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate?
The canonical SMILES for [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate is Cc1cc(C)c2nc(-c3ccc(Cl)cc3)c(C)c(C(=O)Oc3ccc(C(C)(C)c4ccccc4)cc3)c2c1.
What is the InChIKey of [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate?
The InChIKey is GESIFLNAVPZURJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H30ClNO2/c1-21-19-22(2)31-29(20-21)30(23(3)32(36-31)24-11-15-27(35)16-12-24)33(37)38-28-17-13-26(14-18-28)34(4,5)25-9-7-6-8-10-25/h6-20H,1-5H3.
What are the key properties of [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate?
[4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate has a molecular weight of 520.07 g/mol, XLogP of 9.03, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-phenylpropan-2-yl)phenyl] 2-(4-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate is sourced from PubChem (CID 17258128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).