C34H29NO4 — CID 19648458
(2-acetylphenyl) 3,6,8-trimethyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate (PubChem CID 19648458) has the molecular formula C34H29NO4 and a molecular weight of 515.61 g/mol. Its IUPAC name is (2-acetylphenyl) 3,6,8-trimethyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | (2-acetylphenyl) 3,6,8-trimethyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648458 |
| Molecular Formula | C34H29NO4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (2-acetylphenyl) 3,6,8-trimethyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate |
| SMILES | CC(=O)c1ccccc1OC(=O)c1c(C)c(-c2ccc(OCc3ccccc3)cc2)nc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C34H29NO4/c1-21-18-22(2)32-29(19-21)31(34(37)39-30-13-9-8-12-28(30)24(4)36)23(3)33(35-32)26-14-16-27(17-15-26)38-20-25-10-6-5-7-11-25/h5-19H,20H2,1-4H3 |
| InChIKey | RJEXMXWPSXJLRQ-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|