C26H22ClNO3 — CID 19648426
(4-methoxyphenyl) 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate (PubChem CID 19648426) has the molecular formula C26H22ClNO3 and a molecular weight of 431.92 g/mol. Its IUPAC name is (4-methoxyphenyl) 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate.
| Compound Name | (4-methoxyphenyl) 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648426 |
| Molecular Formula | C26H22ClNO3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | (4-methoxyphenyl) 2-(3-chlorophenyl)-3,6,8-trimethylquinoline-4-carboxylate |
| SMILES | COc1ccc(OC(=O)c2c(C)c(-c3cccc(Cl)c3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C26H22ClNO3/c1-15-12-16(2)24-22(13-15)23(26(29)31-21-10-8-20(30-4)9-11-21)17(3)25(28-24)18-6-5-7-19(27)14-18/h5-14H,1-4H3 |
| InChIKey | RAOAZVAGIOMZFM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|