C24H18NO3- — CID 4134698
3-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate (PubChem CID 4134698) has the molecular formula C24H18NO3- and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate.
| Compound Name | 3-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4134698 |
| Molecular Formula | C24H18NO3- |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 3-methyl-2-(4-phenylmethoxyphenyl)quinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccc(OCc3ccccc3)cc2)nc2ccccc2c1C(=O)[O-] |
| InChI | InChI=1S/C24H19NO3/c1-16-22(24(26)27)20-9-5-6-10-21(20)25-23(16)18-11-13-19(14-12-18)28-15-17-7-3-2-4-8-17/h2-14H,15H2,1H3,(H,26,27)/p-1 |
| InChIKey | JRJOPURIBFBFLL-UHFFFAOYSA-M |
| XLogP | 4.15 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |