C22H24N2O2 — CID 4199357
N,N-diethyl-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxamide (PubChem CID 4199357) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N,N-diethyl-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxamide.
| Compound Name | N,N-diethyl-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 4199357 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N,N-diethyl-2-(4-methoxyphenyl)-3-methylquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)c(-c2ccc(OC)cc2)nc2ccccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-5-24(6-2)22(25)20-15(3)21(16-11-13-17(26-4)14-12-16)23-19-10-8-7-9-18(19)20/h7-14H,5-6H2,1-4H3 |
| InChIKey | FVKIDGJDUUFXRH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |