C18H18ClNO — CID 42918992
2-(4-methoxyphenyl)-3,4-dimethylquinoline;hydrochloride (PubChem CID 42918992) has the molecular formula C18H18ClNO and a molecular weight of 299.80 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-3,4-dimethylquinoline;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-3,4-dimethylquinoline;hydrochloride |
|---|---|
| PubChem CID | 42918992 |
| Molecular Formula | C18H18ClNO |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(4-methoxyphenyl)-3,4-dimethylquinoline;hydrochloride |
| SMILES | COc1ccc(-c2nc3ccccc3c(C)c2C)cc1.Cl |
| InChI | InChI=1S/C18H17NO.ClH/c1-12-13(2)18(14-8-10-15(20-3)11-9-14)19-17-7-5-4-6-16(12)17;/h4-11H,1-3H3;1H |
| InChIKey | DNTUTLUBPACWKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |