C16H20N2O — CID 10824990
N,N-diethyl-2,4-dimethylquinoline-3-carboxamide (PubChem CID 10824990) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is N,N-diethyl-2,4-dimethylquinoline-3-carboxamide.
| Compound Name | N,N-diethyl-2,4-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10824990 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N,N-diethyl-2,4-dimethylquinoline-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)nc2ccccc2c1C |
| InChI | InChI=1S/C16H20N2O/c1-5-18(6-2)16(19)15-11(3)13-9-7-8-10-14(13)17-12(15)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | KPWAAGQLHNPJRN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |