C14H16N2O — CID 30331894
N,N,2,4-tetramethylquinoline-3-carboxamide (PubChem CID 30331894) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is N,N,2,4-tetramethylquinoline-3-carboxamide.
| Compound Name | N,N,2,4-tetramethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30331894 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | N,N,2,4-tetramethylquinoline-3-carboxamide |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)N(C)C |
| InChI | InChI=1S/C14H16N2O/c1-9-11-7-5-6-8-12(11)15-10(2)13(9)14(17)16(3)4/h5-8H,1-4H3 |
| InChIKey | ZCWOTOJOQITGJI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |