C18H14ClNO — CID 2439813
(4-chlorophenyl)-(2,4-dimethylquinolin-3-yl)methanone (PubChem CID 2439813) has the molecular formula C18H14ClNO and a molecular weight of 295.77 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,4-dimethylquinolin-3-yl)methanone.
| Compound Name | (4-chlorophenyl)-(2,4-dimethylquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 2439813 |
| Molecular Formula | C18H14ClNO |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | (4-chlorophenyl)-(2,4-dimethylquinolin-3-yl)methanone |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClNO/c1-11-15-5-3-4-6-16(15)20-12(2)17(11)18(21)13-7-9-14(19)10-8-13/h3-10H,1-2H3 |
| InChIKey | WKFFPRGQHYLPSF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |