C16H17NO3 — CID 18276143
3-oxobutan-2-yl 2,4-dimethylquinoline-3-carboxylate (PubChem CID 18276143) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 3-oxobutan-2-yl 2,4-dimethylquinoline-3-carboxylate.
| Compound Name | 3-oxobutan-2-yl 2,4-dimethylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 18276143 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 3-oxobutan-2-yl 2,4-dimethylquinoline-3-carboxylate |
| SMILES | CC(=O)C(C)OC(=O)c1c(C)nc2ccccc2c1C |
| InChI | InChI=1S/C16H17NO3/c1-9-13-7-5-6-8-14(13)17-10(2)15(9)16(19)20-12(4)11(3)18/h5-8,12H,1-4H3 |
| InChIKey | MTZCYUXWARJMLJ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |