About (4-chlorophenyl)-phenylmethanone;propan-2-one
(4-chlorophenyl)-phenylmethanone;propan-2-one (PubChem CID 175521712) has the molecular formula C16H15ClO2
and a molecular weight of 274.75 g/mol. Its IUPAC name is (4-chlorophenyl)-phenylmethanone;propan-2-one.
Molecular Properties
| Compound Name | (4-chlorophenyl)-phenylmethanone;propan-2-one |
| PubChem CID | 175521712 |
| Molecular Formula | C16H15ClO2 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (4-chlorophenyl)-phenylmethanone;propan-2-one |
| SMILES | CC(C)=O.O=C(c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H9ClO.C3H6O/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-3(2)4/h1-9H;1-2H3 |
| InChIKey | ITMBKLRYVWAZIZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-chlorophenyl)-phenylmethanone;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-phenylmethanone;propan-2-one?
The IUPAC name of (4-chlorophenyl)-phenylmethanone;propan-2-one (CID 175521712) is (4-chlorophenyl)-phenylmethanone;propan-2-one.
What is the SMILES notation for (4-chlorophenyl)-phenylmethanone;propan-2-one?
The canonical SMILES for (4-chlorophenyl)-phenylmethanone;propan-2-one is CC(C)=O.O=C(c1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)-phenylmethanone;propan-2-one?
The InChIKey is ITMBKLRYVWAZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClO.C3H6O/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;1-3(2)4/h1-9H;1-2H3.
What are the key properties of (4-chlorophenyl)-phenylmethanone;propan-2-one?
(4-chlorophenyl)-phenylmethanone;propan-2-one has a molecular weight of 274.75 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-phenylmethanone;propan-2-one is sourced from PubChem (CID 175521712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).