C12H13N3O — CID 3811999
2,4-dimethylquinoline-3-carbohydrazide (PubChem CID 3811999) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2,4-dimethylquinoline-3-carbohydrazide.
| Compound Name | 2,4-dimethylquinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 3811999 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2,4-dimethylquinoline-3-carbohydrazide |
| SMILES | Cc1nc2ccccc2c(C)c1C(=O)NN |
| InChI | InChI=1S/C12H13N3O/c1-7-9-5-3-4-6-10(9)14-8(2)11(7)12(16)15-13/h3-6H,13H2,1-2H3,(H,15,16) |
| InChIKey | UZKUOZHMAUHXBO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|