C12H10ClNO — CID 59105963
2,3-dimethylquinoline-4-carbonyl chloride (PubChem CID 59105963) has the molecular formula C12H10ClNO and a molecular weight of 219.67 g/mol. Its IUPAC name is 2,3-dimethylquinoline-4-carbonyl chloride.
| Compound Name | 2,3-dimethylquinoline-4-carbonyl chloride |
|---|---|
| PubChem CID | 59105963 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2,3-dimethylquinoline-4-carbonyl chloride |
| SMILES | Cc1nc2ccccc2c(C(=O)Cl)c1C |
| InChI | InChI=1S/C12H10ClNO/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12(13)15/h3-6H,1-2H3 |
| InChIKey | JFGZOOLORPTHBZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|