2,3-dimethylquinoline-4-carbonyl chloride

C12H10ClNO — CID 59105963

IUPAC2,3-dimethylquinoline-4-carbonyl chloride
SMILESCc1nc2ccccc2c(C(=O)Cl)c1C
InChIInChI=1S/C12H10ClNO/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12(13)15/h3-6H,1-2H3
InChIKeyJFGZOOLORPTHBZ-UHFFFAOYSA-N
MW219.67 g/mol
LogP3.23
Rot. Bonds1

About 2,3-dimethylquinoline-4-carbonyl chloride

2,3-dimethylquinoline-4-carbonyl chloride (PubChem CID 59105963) has the molecular formula C12H10ClNO and a molecular weight of 219.67 g/mol. Its IUPAC name is 2,3-dimethylquinoline-4-carbonyl chloride.

Molecular Properties

Compound Name2,3-dimethylquinoline-4-carbonyl chloride
PubChem CID59105963
Molecular FormulaC12H10ClNO
Molecular Weight219.67 g/mol
Exact Mass219.05
IUPAC Name2,3-dimethylquinoline-4-carbonyl chloride
SMILESCc1nc2ccccc2c(C(=O)Cl)c1C
InChIInChI=1S/C12H10ClNO/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12(13)15/h3-6H,1-2H3
InChIKeyJFGZOOLORPTHBZ-UHFFFAOYSA-N
XLogP3.23
TPSA29.96 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.67
LogP ≤ 53.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,3-dimethylquinoline-4-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethylquinoline-4-carbonyl chloride?
The IUPAC name of 2,3-dimethylquinoline-4-carbonyl chloride (CID 59105963) is 2,3-dimethylquinoline-4-carbonyl chloride.
What is the SMILES notation for 2,3-dimethylquinoline-4-carbonyl chloride?
The canonical SMILES for 2,3-dimethylquinoline-4-carbonyl chloride is Cc1nc2ccccc2c(C(=O)Cl)c1C.
What is the InChIKey of 2,3-dimethylquinoline-4-carbonyl chloride?
The InChIKey is JFGZOOLORPTHBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClNO/c1-7-8(2)14-10-6-4-3-5-9(10)11(7)12(13)15/h3-6H,1-2H3.
What are the key properties of 2,3-dimethylquinoline-4-carbonyl chloride?
2,3-dimethylquinoline-4-carbonyl chloride has a molecular weight of 219.67 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylquinoline-4-carbonyl chloride is sourced from PubChem (CID 59105963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).