About N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine
N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine (PubChem CID 18681645) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine |
| PubChem CID | 18681645 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine |
| SMILES | C=C(c1c(C)c(C)nc2ccccc12)N(C)C(C)(C)C |
| InChI | InChI=1S/C18H24N2/c1-12-13(2)19-16-11-9-8-10-15(16)17(12)14(3)20(7)18(4,5)6/h8-11H,3H2,1-2,4-7H3 |
| InChIKey | UPJVHCQJQVHHJI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine?
The IUPAC name of N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine (CID 18681645) is N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine.
What is the SMILES notation for N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine?
The canonical SMILES for N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine is C=C(c1c(C)c(C)nc2ccccc12)N(C)C(C)(C)C.
What is the InChIKey of N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine?
The InChIKey is UPJVHCQJQVHHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N2/c1-12-13(2)19-16-11-9-8-10-15(16)17(12)14(3)20(7)18(4,5)6/h8-11H,3H2,1-2,4-7H3.
What are the key properties of N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine?
N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine has a molecular weight of 268.40 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,3-dimethylquinolin-4-yl)ethenyl]-N,2-dimethylpropan-2-amine is sourced from PubChem (CID 18681645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).