C18H11NO5-2 — CID 5216026
3-(4-methoxyphenyl)quinoline-2,4-dicarboxylate (PubChem CID 5216026) has the molecular formula C18H11NO5-2 and a molecular weight of 321.29 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)quinoline-2,4-dicarboxylate.
| Compound Name | 3-(4-methoxyphenyl)quinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 5216026 |
| Molecular Formula | C18H11NO5-2 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-(4-methoxyphenyl)quinoline-2,4-dicarboxylate |
| SMILES | COc1ccc(-c2c(C(=O)[O-])nc3ccccc3c2C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H13NO5/c1-24-11-8-6-10(7-9-11)14-15(17(20)21)12-4-2-3-5-13(12)19-16(14)18(22)23/h2-9H,1H3,(H,20,21)(H,22,23)/p-2 |
| InChIKey | CDWWIWDVXOQSLL-UHFFFAOYSA-L |
| XLogP | 0.64 |
| TPSA | 102.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |