C33H28BrNO2 — CID 19648142
[4-(2-phenylpropan-2-yl)phenyl] 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648142) has the molecular formula C33H28BrNO2 and a molecular weight of 550.50 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648142 |
| Molecular Formula | C33H28BrNO2 |
| Molecular Weight | 550.50 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Br)cc3)cc(C(=O)Oc3ccc(C(C)(C)c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C33H28BrNO2/c1-21-18-22(2)31-28(19-21)29(20-30(35-31)23-10-14-26(34)15-11-23)32(36)37-27-16-12-25(13-17-27)33(3,4)24-8-6-5-7-9-24/h5-20H,1-4H3 |
| InChIKey | ODMAYVPQHSZETH-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.50 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|