C26H22FNO2 — CID 19648206
(3,4-dimethylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648206) has the molecular formula C26H22FNO2 and a molecular weight of 399.47 g/mol. Its IUPAC name is (3,4-dimethylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (3,4-dimethylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648206 |
| Molecular Formula | C26H22FNO2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (3,4-dimethylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccc(F)cc3)cc(C(=O)Oc3ccc(C)c(C)c3)c2c1 |
| InChI | InChI=1S/C26H22FNO2/c1-15-11-18(4)25-22(12-15)23(14-24(28-25)19-6-8-20(27)9-7-19)26(29)30-21-10-5-16(2)17(3)13-21/h5-14H,1-4H3 |
| InChIKey | BOADNZAPHSFSMP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|