C24H17Cl2NO2 — CID 19648166
(2-chlorophenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648166) has the molecular formula C24H17Cl2NO2 and a molecular weight of 422.31 g/mol. Its IUPAC name is (2-chlorophenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (2-chlorophenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648166 |
| Molecular Formula | C24H17Cl2NO2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (2-chlorophenyl) 2-(4-chlorophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Cl)cc3)cc(C(=O)Oc3ccccc3Cl)c2c1 |
| InChI | InChI=1S/C24H17Cl2NO2/c1-14-11-15(2)23-18(12-14)19(24(28)29-22-6-4-3-5-20(22)26)13-21(27-23)16-7-9-17(25)10-8-16/h3-13H,1-2H3 |
| InChIKey | OYSTZSMOUSSKHR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|