C28H22N2O2 — CID 19648243
quinolin-8-yl 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate (PubChem CID 19648243) has the molecular formula C28H22N2O2 and a molecular weight of 418.50 g/mol. Its IUPAC name is quinolin-8-yl 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate.
| Compound Name | quinolin-8-yl 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648243 |
| Molecular Formula | C28H22N2O2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | quinolin-8-yl 6,8-dimethyl-2-(4-methylphenyl)quinoline-4-carboxylate |
| SMILES | Cc1ccc(-c2cc(C(=O)Oc3cccc4cccnc34)c3cc(C)cc(C)c3n2)cc1 |
| InChI | InChI=1S/C28H22N2O2/c1-17-9-11-20(12-10-17)24-16-23(22-15-18(2)14-19(3)26(22)30-24)28(31)32-25-8-4-6-21-7-5-13-29-27(21)25/h4-16H,1-3H3 |
| InChIKey | LVVMECKRDHKUHT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|