C27H20N2O2 — CID 19648116
quinolin-8-yl 6,8-dimethyl-2-phenylquinoline-4-carboxylate (PubChem CID 19648116) has the molecular formula C27H20N2O2 and a molecular weight of 404.47 g/mol. Its IUPAC name is quinolin-8-yl 6,8-dimethyl-2-phenylquinoline-4-carboxylate.
| Compound Name | quinolin-8-yl 6,8-dimethyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648116 |
| Molecular Formula | C27H20N2O2 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | quinolin-8-yl 6,8-dimethyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccccc3)cc(C(=O)Oc3cccc4cccnc34)c2c1 |
| InChI | InChI=1S/C27H20N2O2/c1-17-14-18(2)25-21(15-17)22(16-23(29-25)19-8-4-3-5-9-19)27(30)31-24-12-6-10-20-11-7-13-28-26(20)24/h3-16H,1-2H3 |
| InChIKey | APWIMAPWQYIWQR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|