C27H25NO3 — CID 19648301
(3,5-dimethylphenyl) 2-(3-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648301) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3,5-dimethylphenyl) 2-(3-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (3,5-dimethylphenyl) 2-(3-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648301 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3,5-dimethylphenyl) 2-(3-methoxyphenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | COc1cccc(-c2cc(C(=O)Oc3cc(C)cc(C)c3)c3cc(C)cc(C)c3n2)c1 |
| InChI | InChI=1S/C27H25NO3/c1-16-9-17(2)12-22(11-16)31-27(29)24-15-25(20-7-6-8-21(14-20)30-5)28-26-19(4)10-18(3)13-23(24)26/h6-15H,1-5H3 |
| InChIKey | OYXZWRKJIJNNCW-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|