C30H22BrNO2 — CID 17257947
(4-phenylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 17257947) has the molecular formula C30H22BrNO2 and a molecular weight of 508.42 g/mol. Its IUPAC name is (4-phenylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (4-phenylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 17257947 |
| Molecular Formula | C30H22BrNO2 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | (4-phenylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | Cc1cc(C)c2nc(-c3ccc(Br)cc3)cc(C(=O)Oc3ccc(-c4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C30H22BrNO2/c1-19-16-20(2)29-26(17-19)27(18-28(32-29)23-8-12-24(31)13-9-23)30(33)34-25-14-10-22(11-15-25)21-6-4-3-5-7-21/h3-18H,1-2H3 |
| InChIKey | DVQRVEYHCPPKKM-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|