C26H20FNO4 — CID 19648192
(4-methoxycarbonylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 19648192) has the molecular formula C26H20FNO4 and a molecular weight of 429.45 g/mol. Its IUPAC name is (4-methoxycarbonylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (4-methoxycarbonylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 19648192 |
| Molecular Formula | C26H20FNO4 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (4-methoxycarbonylphenyl) 2-(4-fluorophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | COC(=O)c1ccc(OC(=O)c2cc(-c3ccc(F)cc3)nc3c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C26H20FNO4/c1-15-12-16(2)24-21(13-15)22(14-23(28-24)17-4-8-19(27)9-5-17)26(30)32-20-10-6-18(7-11-20)25(29)31-3/h4-14H,1-3H3 |
| InChIKey | LQYJPEQZGIPDMB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|