C26H22BrNO2 — CID 17261744
(2,5-dimethylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 17261744) has the molecular formula C26H22BrNO2 and a molecular weight of 460.37 g/mol. Its IUPAC name is (2,5-dimethylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | (2,5-dimethylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 17261744 |
| Molecular Formula | C26H22BrNO2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | (2,5-dimethylphenyl) 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | Cc1ccc(C)c(OC(=O)c2cc(-c3ccc(Br)cc3)nc3c(C)cc(C)cc23)c1 |
| InChI | InChI=1S/C26H22BrNO2/c1-15-5-6-17(3)24(13-15)30-26(29)22-14-23(19-7-9-20(27)10-8-19)28-25-18(4)11-16(2)12-21(22)25/h5-14H,1-4H3 |
| InChIKey | DOXAOYNMMLRDNB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|