C20H18BrNO2 — CID 17261151
ethyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate (PubChem CID 17261151) has the molecular formula C20H18BrNO2 and a molecular weight of 384.27 g/mol. Its IUPAC name is ethyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate.
| Compound Name | ethyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 17261151 |
| Molecular Formula | C20H18BrNO2 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | ethyl 2-(4-bromophenyl)-6,8-dimethylquinoline-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccc(Br)cc2)nc2c(C)cc(C)cc12 |
| InChI | InChI=1S/C20H18BrNO2/c1-4-24-20(23)17-11-18(14-5-7-15(21)8-6-14)22-19-13(3)9-12(2)10-16(17)19/h5-11H,4H2,1-3H3 |
| InChIKey | ARQQRUJIXMRZHY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |