About 2-phenylquinolin-4-amine;hydrate
2-phenylquinolin-4-amine;hydrate (PubChem CID 51057793) has the molecular formula C15H14N2O
and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-phenylquinolin-4-amine;hydrate.
Molecular Properties
| Compound Name | 2-phenylquinolin-4-amine;hydrate |
| PubChem CID | 51057793 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 2-phenylquinolin-4-amine;hydrate |
| SMILES | Nc1cc(-c2ccccc2)nc2ccccc12.O |
| InChI | InChI=1S/C15H12N2.H2O/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H2,16,17);1H2 |
| InChIKey | IGYXMIOUKSYGLI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylquinolin-4-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylquinolin-4-amine;hydrate?
The IUPAC name of 2-phenylquinolin-4-amine;hydrate (CID 51057793) is 2-phenylquinolin-4-amine;hydrate.
What is the SMILES notation for 2-phenylquinolin-4-amine;hydrate?
The canonical SMILES for 2-phenylquinolin-4-amine;hydrate is Nc1cc(-c2ccccc2)nc2ccccc12.O.
What is the InChIKey of 2-phenylquinolin-4-amine;hydrate?
The InChIKey is IGYXMIOUKSYGLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2.H2O/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14;/h1-10H,(H2,16,17);1H2.
What are the key properties of 2-phenylquinolin-4-amine;hydrate?
2-phenylquinolin-4-amine;hydrate has a molecular weight of 238.29 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylquinolin-4-amine;hydrate is sourced from PubChem (CID 51057793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).