C14H11N3 — CID 11470076
2-phenyl-1,7-naphthyridin-4-amine (PubChem CID 11470076) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-phenyl-1,7-naphthyridin-4-amine.
| Compound Name | 2-phenyl-1,7-naphthyridin-4-amine |
|---|---|
| PubChem CID | 11470076 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-phenyl-1,7-naphthyridin-4-amine |
| SMILES | Nc1cc(-c2ccccc2)nc2cnccc12 |
| InChI | InChI=1S/C14H11N3/c15-12-8-13(10-4-2-1-3-5-10)17-14-9-16-7-6-11(12)14/h1-9H,(H2,15,17) |
| InChIKey | QXZVBBIHMPGNCR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |