C19H19N3Si — CID 90316330
2-[4-(2-trimethylsilylethynyl)phenyl]-1,6-naphthyridin-4-amine (PubChem CID 90316330) has the molecular formula C19H19N3Si and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-[4-(2-trimethylsilylethynyl)phenyl]-1,6-naphthyridin-4-amine.
| Compound Name | 2-[4-(2-trimethylsilylethynyl)phenyl]-1,6-naphthyridin-4-amine |
|---|---|
| PubChem CID | 90316330 |
| Molecular Formula | C19H19N3Si |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 2-[4-(2-trimethylsilylethynyl)phenyl]-1,6-naphthyridin-4-amine |
| SMILES | C[Si](C)(C)C#Cc1ccc(-c2cc(N)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C19H19N3Si/c1-23(2,3)11-9-14-4-6-15(7-5-14)19-12-17(20)16-13-21-10-8-18(16)22-19/h4-8,10,12-13H,1-3H3,(H2,20,22) |
| InChIKey | SWMNJLCHXDYQPY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|