C28H23N5O3 — CID 90304471
2-[4-[2-[4-(morpholine-4-carbonyl)phenyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide (PubChem CID 90304471) has the molecular formula C28H23N5O3 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[4-[2-[4-(morpholine-4-carbonyl)phenyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide.
| Compound Name | 2-[4-[2-[4-(morpholine-4-carbonyl)phenyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 90304471 |
| Molecular Formula | C28H23N5O3 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-[4-[2-[4-(morpholine-4-carbonyl)phenyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide |
| SMILES | NNC(=O)c1cc(-c2ccc(C#Cc3ccc(C(=O)N4CCOCC4)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C28H23N5O3/c29-32-27(34)23-17-26(31-25-11-12-30-18-24(23)25)21-7-3-19(4-8-21)1-2-20-5-9-22(10-6-20)28(35)33-13-15-36-16-14-33/h3-12,17-18H,13-16,29H2,(H,32,34) |
| InChIKey | AQUVHUVXTSVHQP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|