C24H20ClN5O3 — CID 90304609
2-[4-[2-[1-(2-hydroxyethyl)-2-oxo-4-pyridinyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;hydrochloride (PubChem CID 90304609) has the molecular formula C24H20ClN5O3 and a molecular weight of 461.91 g/mol. Its IUPAC name is 2-[4-[2-[1-(2-hydroxyethyl)-2-oxo-4-pyridinyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;hydrochloride.
| Compound Name | 2-[4-[2-[1-(2-hydroxyethyl)-2-oxo-4-pyridinyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 90304609 |
| Molecular Formula | C24H20ClN5O3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-[4-[2-[1-(2-hydroxyethyl)-2-oxo-4-pyridinyl]ethynyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;hydrochloride |
| SMILES | Cl.NNC(=O)c1cc(-c2ccc(C#Cc3ccn(CCO)c(=O)c3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C24H19N5O3.ClH/c25-28-24(32)19-14-22(27-21-7-9-26-15-20(19)21)18-5-3-16(4-6-18)1-2-17-8-10-29(11-12-30)23(31)13-17;/h3-10,13-15,30H,11-12,25H2,(H,28,32);1H |
| InChIKey | BXPSYJJVOURSBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|