C31H28ClN5O4 — CID 90315957
2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid (PubChem CID 90315957) has the molecular formula C31H28ClN5O4 and a molecular weight of 570.05 g/mol. Its IUPAC name is 2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid.
| Compound Name | 2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 90315957 |
| Molecular Formula | C31H28ClN5O4 |
| Molecular Weight | 570.05 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 2-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-(2-methylpropyl)amino]propanoic acid |
| SMILES | CC(C)CN(C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NN)c4cnccc4n3)cc2)c(Cl)c1)C(C)C(=O)O |
| InChI | InChI=1S/C31H28ClN5O4/c1-18(2)17-37(19(3)31(40)41)30(39)23-11-10-21(26(32)14-23)7-4-20-5-8-22(9-6-20)28-15-24(29(38)36-33)25-16-34-13-12-27(25)35-28/h5-6,8-16,18-19H,17,33H2,1-3H3,(H,36,38)(H,40,41) |
| InChIKey | JDIYEIKZMVBRIO-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.05 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|