C28H23ClN6O4 — CID 90315961
2-amino-3-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-methylamino]propanoic acid (PubChem CID 90315961) has the molecular formula C28H23ClN6O4 and a molecular weight of 542.98 g/mol. Its IUPAC name is 2-amino-3-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-methylamino]propanoic acid.
| Compound Name | 2-amino-3-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 90315961 |
| Molecular Formula | C28H23ClN6O4 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 2-amino-3-[[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]benzoyl]-methylamino]propanoic acid |
| SMILES | CN(CC(N)C(=O)O)C(=O)c1ccc(C#Cc2ccc(-c3cc(C(=O)NN)c4cnccc4n3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C28H23ClN6O4/c1-35(15-23(30)28(38)39)27(37)19-9-8-17(22(29)12-19)5-2-16-3-6-18(7-4-16)25-13-20(26(36)34-31)21-14-32-11-10-24(21)33-25/h3-4,6-14,23H,15,30-31H2,1H3,(H,34,36)(H,38,39) |
| InChIKey | FUCRKQIHTHLVNY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 164.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|