C28H22ClN5O5S — CID 123564933
1-[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 123564933) has the molecular formula C28H22ClN5O5S and a molecular weight of 576.03 g/mol. Its IUPAC name is 1-[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 123564933 |
| Molecular Formula | C28H22ClN5O5S |
| Molecular Weight | 576.03 g/mol |
| Exact Mass | 575.10 |
| IUPAC Name | 1-[3-chloro-4-[2-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]ethynyl]phenyl]sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | NNC(=O)c1cc(-c2ccc(C#Cc3ccc(S(=O)(=O)N4CCCC4C(=O)O)cc3Cl)cc2)nc2ccncc12 |
| InChI | InChI=1S/C28H22ClN5O5S/c29-23-14-20(40(38,39)34-13-1-2-26(34)28(36)37)10-9-18(23)6-3-17-4-7-19(8-5-17)25-15-21(27(35)33-30)22-16-31-12-11-24(22)32-25/h4-5,7-12,14-16,26H,1-2,13,30H2,(H,33,35)(H,36,37) |
| InChIKey | SBUVEHNNSQBSBZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.03 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|