C27H25N5O5S — CID 90316052
(2R)-1-[[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]methylsulfonyl]pyrrolidine-2-carboxylic acid (PubChem CID 90316052) has the molecular formula C27H25N5O5S and a molecular weight of 531.59 g/mol. Its IUPAC name is (2R)-1-[[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]methylsulfonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]methylsulfonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 90316052 |
| Molecular Formula | C27H25N5O5S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (2R)-1-[[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenyl]methylsulfonyl]pyrrolidine-2-carboxylic acid |
| SMILES | NNC(=O)c1cc(-c2ccc(-c3ccc(CS(=O)(=O)N4CCC[C@@H]4C(=O)O)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C27H25N5O5S/c28-31-26(33)21-14-24(30-23-11-12-29-15-22(21)23)20-9-7-19(8-10-20)18-5-3-17(4-6-18)16-38(36,37)32-13-1-2-25(32)27(34)35/h3-12,14-15,25H,1-2,13,16,28H2,(H,31,33)(H,34,35)/t25-/m1/s1 |
| InChIKey | ZDKOSBDWEUVSOZ-RUZDIDTESA-N |
| XLogP | 2.95 |
| TPSA | 155.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|