C32H30N6O5 — CID 144675128
2-[4-[4-[5-(2-formylpiperidine-1-carbonyl)-1,2-oxazol-3-yl]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;methanol (PubChem CID 144675128) has the molecular formula C32H30N6O5 and a molecular weight of 578.63 g/mol. Its IUPAC name is 2-[4-[4-[5-(2-formylpiperidine-1-carbonyl)-1,2-oxazol-3-yl]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;methanol.
| Compound Name | 2-[4-[4-[5-(2-formylpiperidine-1-carbonyl)-1,2-oxazol-3-yl]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;methanol |
|---|---|
| PubChem CID | 144675128 |
| Molecular Formula | C32H30N6O5 |
| Molecular Weight | 578.63 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 2-[4-[4-[5-(2-formylpiperidine-1-carbonyl)-1,2-oxazol-3-yl]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide;methanol |
| SMILES | CO.NNC(=O)c1cc(-c2ccc(-c3ccc(-c4cc(C(=O)N5CCCCC5C=O)on4)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C31H26N6O4.CH4O/c32-35-30(39)24-15-27(34-26-12-13-33-17-25(24)26)21-8-4-19(5-9-21)20-6-10-22(11-7-20)28-16-29(41-36-28)31(40)37-14-2-1-3-23(37)18-38;1-2/h4-13,15-18,23H,1-3,14,32H2,(H,35,39);2H,1H3 |
| InChIKey | MRMRDLSOCKZOKR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|