C27H29N5O3 — CID 144674882
acetaldehyde;2-[4-[4-[3-(methylamino)propoxy]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide (PubChem CID 144674882) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is acetaldehyde;2-[4-[4-[3-(methylamino)propoxy]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide.
| Compound Name | acetaldehyde;2-[4-[4-[3-(methylamino)propoxy]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 144674882 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | acetaldehyde;2-[4-[4-[3-(methylamino)propoxy]phenyl]phenyl]-1,6-naphthyridine-4-carbohydrazide |
| SMILES | CC=O.CNCCCOc1ccc(-c2ccc(-c3cc(C(=O)NN)c4cnccc4n3)cc2)cc1 |
| InChI | InChI=1S/C25H25N5O2.C2H4O/c1-27-12-2-14-32-20-9-7-18(8-10-20)17-3-5-19(6-4-17)24-15-21(25(31)30-26)22-16-28-13-11-23(22)29-24;1-2-3/h3-11,13,15-16,27H,2,12,14,26H2,1H3,(H,30,31);2H,1H3 |
| InChIKey | YBBFDQSHGKPOHB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|