C20H21N3O2 — CID 3492380
2-(3-butoxyphenyl)quinoline-4-carbohydrazide (PubChem CID 3492380) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-(3-butoxyphenyl)quinoline-4-carbohydrazide.
| Compound Name | 2-(3-butoxyphenyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 3492380 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-(3-butoxyphenyl)quinoline-4-carbohydrazide |
| SMILES | CCCCOc1cccc(-c2cc(C(=O)NN)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-2-3-11-25-15-8-6-7-14(12-15)19-13-17(20(24)23-21)16-9-4-5-10-18(16)22-19/h4-10,12-13H,2-3,11,21H2,1H3,(H,23,24) |
| InChIKey | YDJARPOSGISVPM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|