C25H30N4O3 — CID 11838247
1-butyl-3-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]amino]urea (PubChem CID 11838247) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-butyl-3-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]amino]urea.
| Compound Name | 1-butyl-3-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]amino]urea |
|---|---|
| PubChem CID | 11838247 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-butyl-3-[[2-[3-(2-methylpropoxy)phenyl]quinoline-4-carbonyl]amino]urea |
| SMILES | CCCCNC(=O)NNC(=O)c1cc(-c2cccc(OCC(C)C)c2)nc2ccccc12 |
| InChI | InChI=1S/C25H30N4O3/c1-4-5-13-26-25(31)29-28-24(30)21-15-23(27-22-12-7-6-11-20(21)22)18-9-8-10-19(14-18)32-16-17(2)3/h6-12,14-15,17H,4-5,13,16H2,1-3H3,(H,28,30)(H2,26,29,31) |
| InChIKey | TZZGTDOMEGRRRT-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|