C23H26N4O2S — CID 22301212
1-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-1-ethylthiourea (PubChem CID 22301212) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 1-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-1-ethylthiourea.
| Compound Name | 1-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-1-ethylthiourea |
|---|---|
| PubChem CID | 22301212 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 1-[[2-(3-butoxyphenyl)quinoline-4-carbonyl]amino]-1-ethylthiourea |
| SMILES | CCCCOc1cccc(-c2cc(C(=O)NN(CC)C(N)=S)c3ccccc3n2)c1 |
| InChI | InChI=1S/C23H26N4O2S/c1-3-5-13-29-17-10-8-9-16(14-17)21-15-19(18-11-6-7-12-20(18)25-21)22(28)26-27(4-2)23(24)30/h6-12,14-15H,3-5,13H2,1-2H3,(H2,24,30)(H,26,28) |
| InChIKey | OYBXZWHSGRNEIO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|