C30H31N3O5 — CID 6873333
2-(3-butoxyphenyl)-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]quinoline-4-carboxamide (PubChem CID 6873333) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-(3-butoxyphenyl)-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]quinoline-4-carboxamide.
| Compound Name | 2-(3-butoxyphenyl)-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 6873333 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 2-(3-butoxyphenyl)-N-[(E)-(2,3,4-trimethoxyphenyl)methylideneamino]quinoline-4-carboxamide |
| SMILES | CCCCOc1cccc(-c2cc(C(=O)N/N=C/c3ccc(OC)c(OC)c3OC)c3ccccc3n2)c1 |
| InChI | InChI=1S/C30H31N3O5/c1-5-6-16-38-22-11-9-10-20(17-22)26-18-24(23-12-7-8-13-25(23)32-26)30(34)33-31-19-21-14-15-27(35-2)29(37-4)28(21)36-3/h7-15,17-19H,5-6,16H2,1-4H3,(H,33,34)/b31-19+ |
| InChIKey | SIUICTPPCVTFLT-ZCTHSVRISA-N |
| XLogP | 5.87 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|